C17H20N2O5 — CID 7808964
N'-[2-(3,4-dimethoxyphenyl)acetyl]-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 7808964) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxyphenyl)acetyl]-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-[2-(3,4-dimethoxyphenyl)acetyl]-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 7808964 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N'-[2-(3,4-dimethoxyphenyl)acetyl]-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | COc1ccc(CC(=O)NNC(=O)c2cc(C)oc2C)cc1OC |
| InChI | InChI=1S/C17H20N2O5/c1-10-7-13(11(2)24-10)17(21)19-18-16(20)9-12-5-6-14(22-3)15(8-12)23-4/h5-8H,9H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | PNARIQHZJRFWNN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|