C25H28N2O6 — CID 4308006
N-[1,2-bis(3,4-dimethoxyphenyl)ethylideneamino]-2,5-dimethylfuran-3-carboxamide (PubChem CID 4308006) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[1,2-bis(3,4-dimethoxyphenyl)ethylideneamino]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[1,2-bis(3,4-dimethoxyphenyl)ethylideneamino]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 4308006 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-[1,2-bis(3,4-dimethoxyphenyl)ethylideneamino]-2,5-dimethylfuran-3-carboxamide |
| SMILES | COc1ccc(CC(=NNC(=O)c2cc(C)oc2C)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H28N2O6/c1-15-11-19(16(2)33-15)25(28)27-26-20(18-8-10-22(30-4)24(14-18)32-6)12-17-7-9-21(29-3)23(13-17)31-5/h7-11,13-14H,12H2,1-6H3,(H,27,28) |
| InChIKey | MLWAQFCIBUVGFR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|