C15H16O4 — CID 43463044
(3,4-dimethoxyphenyl)-(2,5-dimethylfuran-3-yl)methanone (PubChem CID 43463044) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(2,5-dimethylfuran-3-yl)methanone.
| Compound Name | (3,4-dimethoxyphenyl)-(2,5-dimethylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 43463044 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(2,5-dimethylfuran-3-yl)methanone |
| SMILES | COc1ccc(C(=O)c2cc(C)oc2C)cc1OC |
| InChI | InChI=1S/C15H16O4/c1-9-7-12(10(2)19-9)15(16)11-5-6-13(17-3)14(8-11)18-4/h5-8H,1-4H3 |
| InChIKey | WAZFRHMNJWOQIU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |