C17H17BrO5 — CID 129012233
(2-bromo-3,4-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methanone (PubChem CID 129012233) has the molecular formula C17H17BrO5 and a molecular weight of 381.22 g/mol. Its IUPAC name is (2-bromo-3,4-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methanone.
| Compound Name | (2-bromo-3,4-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 129012233 |
| Molecular Formula | C17H17BrO5 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | (2-bromo-3,4-dimethoxyphenyl)-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccc(OC)c(OC)c2Br)cc1OC |
| InChI | InChI=1S/C17H17BrO5/c1-20-12-7-5-10(9-14(12)22-3)16(19)11-6-8-13(21-2)17(23-4)15(11)18/h5-9H,1-4H3 |
| InChIKey | NCSGCWFBVTWEOE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |