C15H15IN2O4 — CID 55332060
N'-[2-(4-iodophenoxy)acetyl]-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 55332060) has the molecular formula C15H15IN2O4 and a molecular weight of 414.20 g/mol. Its IUPAC name is N'-[2-(4-iodophenoxy)acetyl]-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-[2-(4-iodophenoxy)acetyl]-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 55332060 |
| Molecular Formula | C15H15IN2O4 |
| Molecular Weight | 414.20 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | N'-[2-(4-iodophenoxy)acetyl]-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)COc2ccc(I)cc2)c(C)o1 |
| InChI | InChI=1S/C15H15IN2O4/c1-9-7-13(10(2)22-9)15(20)18-17-14(19)8-21-12-5-3-11(16)4-6-12/h3-7H,8H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | BSGSMMSIMJRIKB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|