C16H17ClN2O4 — CID 9468212
N'-[2-(2-chloro-5-methylphenoxy)acetyl]-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 9468212) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is N'-[2-(2-chloro-5-methylphenoxy)acetyl]-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-[2-(2-chloro-5-methylphenoxy)acetyl]-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 9468212 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N'-[2-(2-chloro-5-methylphenoxy)acetyl]-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | Cc1ccc(Cl)c(OCC(=O)NNC(=O)c2cc(C)oc2C)c1 |
| InChI | InChI=1S/C16H17ClN2O4/c1-9-4-5-13(17)14(6-9)22-8-15(20)18-19-16(21)12-7-10(2)23-11(12)3/h4-7H,8H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | JPJQWZATMRAKBC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|