C15H16N4O5 — CID 9156552
2,5-dimethyl-N'-[4-(methylamino)-3-nitrobenzoyl]furan-3-carbohydrazide (PubChem CID 9156552) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[4-(methylamino)-3-nitrobenzoyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[4-(methylamino)-3-nitrobenzoyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 9156552 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2,5-dimethyl-N'-[4-(methylamino)-3-nitrobenzoyl]furan-3-carbohydrazide |
| SMILES | CNc1ccc(C(=O)NNC(=O)c2cc(C)oc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N4O5/c1-8-6-11(9(2)24-8)15(21)18-17-14(20)10-4-5-12(16-3)13(7-10)19(22)23/h4-7,16H,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | COVXLBYCAIUQOX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|