C19H21N5O6S — CID 46652855
4-(methylamino)-3-nitro-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide (PubChem CID 46652855) has the molecular formula C19H21N5O6S and a molecular weight of 447.47 g/mol. Its IUPAC name is 4-(methylamino)-3-nitro-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide.
| Compound Name | 4-(methylamino)-3-nitro-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 46652855 |
| Molecular Formula | C19H21N5O6S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-(methylamino)-3-nitro-N'-(4-pyrrolidin-1-ylsulfonylbenzoyl)benzohydrazide |
| SMILES | CNc1ccc(C(=O)NNC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21N5O6S/c1-20-16-9-6-14(12-17(16)24(27)28)19(26)22-21-18(25)13-4-7-15(8-5-13)31(29,30)23-10-2-3-11-23/h4-9,12,20H,2-3,10-11H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | ZRCYBFKNRJECIM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|