C16H22N4O3 — CID 100839712
N-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-4-(methylamino)-3-nitrobenzamide (PubChem CID 100839712) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-4-(methylamino)-3-nitrobenzamide.
| Compound Name | N-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-4-(methylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 100839712 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-4-(methylamino)-3-nitrobenzamide |
| SMILES | CNc1ccc(C(=O)N[C@@H]2CCN3CCCC[C@@H]23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O3/c1-17-12-6-5-11(10-15(12)20(22)23)16(21)18-13-7-9-19-8-3-2-4-14(13)19/h5-6,10,13-14,17H,2-4,7-9H2,1H3,(H,18,21)/t13-,14+/m1/s1 |
| InChIKey | YWRWDGPMZJUEIH-KGLIPLIRSA-N |
| XLogP | 1.99 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|