C15H19FN2OS — CID 107025814
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-4-fluoro-3-sulfanylbenzamide (PubChem CID 107025814) has the molecular formula C15H19FN2OS and a molecular weight of 294.39 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-4-fluoro-3-sulfanylbenzamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-4-fluoro-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107025814 |
| Molecular Formula | C15H19FN2OS |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-4-fluoro-3-sulfanylbenzamide |
| SMILES | O=C(NC1CCN2CCCCC12)c1ccc(F)c(S)c1 |
| InChI | InChI=1S/C15H19FN2OS/c16-11-5-4-10(9-14(11)20)15(19)17-12-6-8-18-7-2-1-3-13(12)18/h4-5,9,12-13,20H,1-3,6-8H2,(H,17,19) |
| InChIKey | ZODKLYIBHIYBLB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|