C15H18F2N2O3S — CID 95285548
N-[(3S,4S)-1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl]-3,4-difluorobenzamide (PubChem CID 95285548) has the molecular formula C15H18F2N2O3S and a molecular weight of 344.38 g/mol. Its IUPAC name is N-[(3S,4S)-1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl]-3,4-difluorobenzamide.
| Compound Name | N-[(3S,4S)-1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 95285548 |
| Molecular Formula | C15H18F2N2O3S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[(3S,4S)-1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl]-3,4-difluorobenzamide |
| SMILES | O=C(N[C@@H]1CS(=O)(=O)C[C@H]1N1CCCC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H18F2N2O3S/c16-11-4-3-10(7-12(11)17)15(20)18-13-8-23(21,22)9-14(13)19-5-1-2-6-19/h3-4,7,13-14H,1-2,5-6,8-9H2,(H,18,20)/t13-,14-/m1/s1 |
| InChIKey | GTWOWIZCFMJZDB-ZIAGYGMSSA-N |
| XLogP | 0.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |