C23H29N3O5S2 — CID 95352761
N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-4-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 95352761) has the molecular formula C23H29N3O5S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-4-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-4-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 95352761 |
| Molecular Formula | C23H29N3O5S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-4-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)N[C@@H]2CS(=O)(=O)C[C@@H]2N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H29N3O5S2/c1-25(19-8-4-2-5-9-19)33(30,31)20-12-10-18(11-13-20)23(27)24-21-16-32(28,29)17-22(21)26-14-6-3-7-15-26/h2,4-5,8-13,21-22H,3,6-7,14-17H2,1H3,(H,24,27)/t21-,22+/m1/s1 |
| InChIKey | QRJVSLDCLPBSPD-YADHBBJMSA-N |
| XLogP | 1.89 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |