C17H21N3O3S — CID 95290887
3-cyano-N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]benzamide (PubChem CID 95290887) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 3-cyano-N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]benzamide.
| Compound Name | 3-cyano-N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 95290887 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-cyano-N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]benzamide |
| SMILES | N#Cc1cccc(C(=O)N[C@@H]2CS(=O)(=O)C[C@@H]2N2CCCCC2)c1 |
| InChI | InChI=1S/C17H21N3O3S/c18-10-13-5-4-6-14(9-13)17(21)19-15-11-24(22,23)12-16(15)20-7-2-1-3-8-20/h4-6,9,15-16H,1-3,7-8,11-12H2,(H,19,21)/t15-,16+/m1/s1 |
| InChIKey | YGVYZSGVQDLRDY-CVEARBPZSA-N |
| XLogP | 0.94 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |