C10H10F2N2O — CID 43593845
N-(2-aminocyclopropyl)-3,4-difluorobenzamide (PubChem CID 43593845) has the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. Its IUPAC name is N-(2-aminocyclopropyl)-3,4-difluorobenzamide.
| Compound Name | N-(2-aminocyclopropyl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 43593845 |
| Molecular Formula | C10H10F2N2O |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | N-(2-aminocyclopropyl)-3,4-difluorobenzamide |
| SMILES | NC1CC1NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H10F2N2O/c11-6-2-1-5(3-7(6)12)10(15)14-9-4-8(9)13/h1-3,8-9H,4,13H2,(H,14,15) |
| InChIKey | IKZKKMJZBCYDFP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |