C13H16ClFN2O — CID 114024825
N-[(1R,2R)-2-aminocyclohexyl]-4-chloro-3-fluorobenzamide (PubChem CID 114024825) has the molecular formula C13H16ClFN2O and a molecular weight of 270.73 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-4-chloro-3-fluorobenzamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-4-chloro-3-fluorobenzamide |
|---|---|
| PubChem CID | 114024825 |
| Molecular Formula | C13H16ClFN2O |
| Molecular Weight | 270.73 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-4-chloro-3-fluorobenzamide |
| SMILES | N[C@@H]1CCCC[C@H]1NC(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H16ClFN2O/c14-9-6-5-8(7-10(9)15)13(18)17-12-4-2-1-3-11(12)16/h5-7,11-12H,1-4,16H2,(H,17,18)/t11-,12-/m1/s1 |
| InChIKey | VYIBMOMBHMWMRL-VXGBXAGGSA-N |
| XLogP | 2.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.73 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |