C14H17F3N2O — CID 63258010
N-(2-aminocycloheptyl)-3,4,5-trifluorobenzamide (PubChem CID 63258010) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is N-(2-aminocycloheptyl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(2-aminocycloheptyl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 63258010 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-(2-aminocycloheptyl)-3,4,5-trifluorobenzamide |
| SMILES | NC1CCCCCC1NC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H17F3N2O/c15-9-6-8(7-10(16)13(9)17)14(20)19-12-5-3-1-2-4-11(12)18/h6-7,11-12H,1-5,18H2,(H,19,20) |
| InChIKey | VAYNIQHFAGSBDJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|