C16H18F2N2O2 — CID 59290522
N-(2-aminocyclohexyl)-3,5-difluoro-4-prop-2-ynoxybenzamide (PubChem CID 59290522) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is N-(2-aminocyclohexyl)-3,5-difluoro-4-prop-2-ynoxybenzamide.
| Compound Name | N-(2-aminocyclohexyl)-3,5-difluoro-4-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 59290522 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(2-aminocyclohexyl)-3,5-difluoro-4-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1c(F)cc(C(=O)NC2CCCCC2N)cc1F |
| InChI | InChI=1S/C16H18F2N2O2/c1-2-7-22-15-11(17)8-10(9-12(15)18)16(21)20-14-6-4-3-5-13(14)19/h1,8-9,13-14H,3-7,19H2,(H,20,21) |
| InChIKey | BHJDWSMJISTHOE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|