C16H17F2NO2 — CID 57445704
N-(cyclopentylmethyl)-3,5-difluoro-4-prop-2-ynoxybenzamide (PubChem CID 57445704) has the molecular formula C16H17F2NO2 and a molecular weight of 293.31 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-3,5-difluoro-4-prop-2-ynoxybenzamide.
| Compound Name | N-(cyclopentylmethyl)-3,5-difluoro-4-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 57445704 |
| Molecular Formula | C16H17F2NO2 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-(cyclopentylmethyl)-3,5-difluoro-4-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1c(F)cc(C(=O)NCC2CCCC2)cc1F |
| InChI | InChI=1S/C16H17F2NO2/c1-2-7-21-15-13(17)8-12(9-14(15)18)16(20)19-10-11-5-3-4-6-11/h1,8-9,11H,3-7,10H2,(H,19,20) |
| InChIKey | CXXZZFXNFPPYSE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|