C17H18F3NO2 — CID 59226988
N-(cyclohexylmethyl)-2,3,5-trifluoro-4-prop-2-ynoxybenzamide (PubChem CID 59226988) has the molecular formula C17H18F3NO2 and a molecular weight of 325.33 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2,3,5-trifluoro-4-prop-2-ynoxybenzamide.
| Compound Name | N-(cyclohexylmethyl)-2,3,5-trifluoro-4-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 59226988 |
| Molecular Formula | C17H18F3NO2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-(cyclohexylmethyl)-2,3,5-trifluoro-4-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1c(F)cc(C(=O)NCC2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C17H18F3NO2/c1-2-8-23-16-13(18)9-12(14(19)15(16)20)17(22)21-10-11-6-4-3-5-7-11/h1,9,11H,3-8,10H2,(H,21,22) |
| InChIKey | ICLVBFVZIAOMCO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|