C23H26F3NO3 — CID 171801997
2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]-N-[(4-methylcyclohexyl)methyl]benzamide (PubChem CID 171801997) has the molecular formula C23H26F3NO3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]-N-[(4-methylcyclohexyl)methyl]benzamide.
| Compound Name | 2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]-N-[(4-methylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 171801997 |
| Molecular Formula | C23H26F3NO3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]-N-[(4-methylcyclohexyl)methyl]benzamide |
| SMILES | COc1ccc(COc2c(F)cc(C(=O)NCC3CCC(C)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C23H26F3NO3/c1-14-3-5-15(6-4-14)12-27-23(28)18-11-19(24)22(21(26)20(18)25)30-13-16-7-9-17(29-2)10-8-16/h7-11,14-15H,3-6,12-13H2,1-2H3,(H,27,28) |
| InChIKey | QOLCVAMCJAZAFD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|