C24H26F3NO5 — CID 171767714
methyl 4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]cyclohexane-1-carboxylate (PubChem CID 171767714) has the molecular formula C24H26F3NO5 and a molecular weight of 465.47 g/mol. Its IUPAC name is methyl 4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 171767714 |
| Molecular Formula | C24H26F3NO5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | methyl 4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(CNC(=O)c2cc(F)c(OCc3ccc(OC)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C24H26F3NO5/c1-31-17-9-5-15(6-10-17)13-33-22-19(25)11-18(20(26)21(22)27)23(29)28-12-14-3-7-16(8-4-14)24(30)32-2/h5-6,9-11,14,16H,3-4,7-8,12-13H2,1-2H3,(H,28,29) |
| InChIKey | ZYZMXPQWDZUBPP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|