C34H38F3N5O3 — CID 171469303
2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]-N-[[4-[6-(4-methylpiperazin-1-yl)indazol-2-yl]cyclohexyl]methyl]benzamide (PubChem CID 171469303) has the molecular formula C34H38F3N5O3 and a molecular weight of 621.70 g/mol. Its IUPAC name is 2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]-N-[[4-[6-(4-methylpiperazin-1-yl)indazol-2-yl]cyclohexyl]methyl]benzamide.
| Compound Name | 2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]-N-[[4-[6-(4-methylpiperazin-1-yl)indazol-2-yl]cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 171469303 |
| Molecular Formula | C34H38F3N5O3 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | 2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]-N-[[4-[6-(4-methylpiperazin-1-yl)indazol-2-yl]cyclohexyl]methyl]benzamide |
| SMILES | COc1ccc(COc2c(F)cc(C(=O)NCC3CCC(n4cc5ccc(N6CCN(C)CC6)cc5n4)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C34H38F3N5O3/c1-40-13-15-41(16-14-40)26-10-7-24-20-42(39-30(24)17-26)25-8-3-22(4-9-25)19-38-34(43)28-18-29(35)33(32(37)31(28)36)45-21-23-5-11-27(44-2)12-6-23/h5-7,10-12,17-18,20,22,25H,3-4,8-9,13-16,19,21H2,1-2H3,(H,38,43) |
| InChIKey | IMXYTRFFGXVZDN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|