C22H20F5N3O2 — CID 171503854
N-[[4-[6-(difluoromethyl)indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide (PubChem CID 171503854) has the molecular formula C22H20F5N3O2 and a molecular weight of 453.41 g/mol. Its IUPAC name is N-[[4-[6-(difluoromethyl)indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide.
| Compound Name | N-[[4-[6-(difluoromethyl)indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 171503854 |
| Molecular Formula | C22H20F5N3O2 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[[4-[6-(difluoromethyl)indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide |
| SMILES | O=C(NCC1CCC(n2cc3ccc(C(F)F)cc3n2)CC1)c1cc(F)c(O)c(F)c1F |
| InChI | InChI=1S/C22H20F5N3O2/c23-16-8-15(18(24)19(25)20(16)31)22(32)28-9-11-1-5-14(6-2-11)30-10-13-4-3-12(21(26)27)7-17(13)29-30/h3-4,7-8,10-11,14,21,31H,1-2,5-6,9H2,(H,28,32) |
| InChIKey | PFVDNMNEGRDJNT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|