C39H42F3N9O4 — CID 171767820
N-[[4-[6-[4-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)imidazo[1,2-a]pyridin-7-yl]propyl]piperazin-1-yl]indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide (PubChem CID 171767820) has the molecular formula C39H42F3N9O4 and a molecular weight of 757.82 g/mol. Its IUPAC name is N-[[4-[6-[4-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)imidazo[1,2-a]pyridin-7-yl]propyl]piperazin-1-yl]indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide.
| Compound Name | N-[[4-[6-[4-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)imidazo[1,2-a]pyridin-7-yl]propyl]piperazin-1-yl]indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 171767820 |
| Molecular Formula | C39H42F3N9O4 |
| Molecular Weight | 757.82 g/mol |
| Exact Mass | 757.33 |
| IUPAC Name | N-[[4-[6-[4-[3-[3-(2,4-dioxo-1,3-diazinan-1-yl)imidazo[1,2-a]pyridin-7-yl]propyl]piperazin-1-yl]indazol-2-yl]cyclohexyl]methyl]-2,3,5-trifluoro-4-hydroxybenzamide |
| SMILES | O=C1CCN(c2cnc3cc(CCCN4CCN(c5ccc6cn(C7CCC(CNC(=O)c8cc(F)c(O)c(F)c8F)CC7)nc6c5)CC4)ccn23)C(=O)N1 |
| InChI | InChI=1S/C39H42F3N9O4/c40-30-20-29(35(41)36(42)37(30)53)38(54)44-21-25-3-6-27(7-4-25)51-23-26-5-8-28(19-31(26)46-51)48-16-14-47(15-17-48)11-1-2-24-9-12-49-32(18-24)43-22-34(49)50-13-10-33(52)45-39(50)55/h5,8-9,12,18-20,22-23,25,27,53H,1-4,6-7,10-11,13-17,21H2,(H,44,54)(H,45,52,55) |
| InChIKey | CVYDVFKWAYQLGX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.82 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|