C41H42F3N5O5 — CID 171767711
tert-butyl 2-[2-[4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]cyclohexyl]indazol-6-yl]-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate (PubChem CID 171767711) has the molecular formula C41H42F3N5O5 and a molecular weight of 741.81 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]cyclohexyl]indazol-6-yl]-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate.
| Compound Name | tert-butyl 2-[2-[4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]cyclohexyl]indazol-6-yl]-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 171767711 |
| Molecular Formula | C41H42F3N5O5 |
| Molecular Weight | 741.81 g/mol |
| Exact Mass | 741.31 |
| IUPAC Name | tert-butyl 2-[2-[4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]cyclohexyl]indazol-6-yl]-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate |
| SMILES | COc1ccc(COc2c(F)cc(C(=O)NCC3CCC(n4cc5ccc(-c6ccc7c(n6)CN(C(=O)OC(C)(C)C)C7)cc5n4)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C41H42F3N5O5/c1-41(2,3)54-40(51)48-20-27-11-16-33(46-35(27)22-48)26-9-10-28-21-49(47-34(28)17-26)29-12-5-24(6-13-29)19-45-39(50)31-18-32(42)38(37(44)36(31)43)53-23-25-7-14-30(52-4)15-8-25/h7-11,14-18,21,24,29H,5-6,12-13,19-20,22-23H2,1-4H3,(H,45,50) |
| InChIKey | XJDADYJHENJRIW-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.81 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|