C22H24N2O5 — CID 155438450
methyl 6-[(4-methoxyphenyl)methoxy]-2-(oxan-4-yl)indazole-5-carboxylate (PubChem CID 155438450) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is methyl 6-[(4-methoxyphenyl)methoxy]-2-(oxan-4-yl)indazole-5-carboxylate.
| Compound Name | methyl 6-[(4-methoxyphenyl)methoxy]-2-(oxan-4-yl)indazole-5-carboxylate |
|---|---|
| PubChem CID | 155438450 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | methyl 6-[(4-methoxyphenyl)methoxy]-2-(oxan-4-yl)indazole-5-carboxylate |
| SMILES | COC(=O)c1cc2cn(C3CCOCC3)nc2cc1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-26-18-5-3-15(4-6-18)14-29-21-12-20-16(11-19(21)22(25)27-2)13-24(23-20)17-7-9-28-10-8-17/h3-6,11-13,17H,7-10,14H2,1-2H3 |
| InChIKey | QZGYMFXWJYRBLU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |