C24H28N4O4 — CID 161198224
2-[6-methoxy-2-(oxan-4-yl)indazol-5-yl]-1-(6-morpholin-4-yl-2-pyridinyl)ethanone (PubChem CID 161198224) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[6-methoxy-2-(oxan-4-yl)indazol-5-yl]-1-(6-morpholin-4-yl-2-pyridinyl)ethanone.
| Compound Name | 2-[6-methoxy-2-(oxan-4-yl)indazol-5-yl]-1-(6-morpholin-4-yl-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 161198224 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[6-methoxy-2-(oxan-4-yl)indazol-5-yl]-1-(6-morpholin-4-yl-2-pyridinyl)ethanone |
| SMILES | COc1cc2nn(C3CCOCC3)cc2cc1CC(=O)c1cccc(N2CCOCC2)n1 |
| InChI | InChI=1S/C24H28N4O4/c1-30-23-15-21-18(16-28(26-21)19-5-9-31-10-6-19)13-17(23)14-22(29)20-3-2-4-24(25-20)27-7-11-32-12-8-27/h2-4,13,15-16,19H,5-12,14H2,1H3 |
| InChIKey | UUQDQZLDTWPCOS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |