C21H21F3N4O2 — CID 158482410
2-(6-methoxy-2-piperidin-4-ylindazol-5-yl)-1-[6-(trifluoromethyl)-2-pyridinyl]ethanone (PubChem CID 158482410) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is 2-(6-methoxy-2-piperidin-4-ylindazol-5-yl)-1-[6-(trifluoromethyl)-2-pyridinyl]ethanone.
| Compound Name | 2-(6-methoxy-2-piperidin-4-ylindazol-5-yl)-1-[6-(trifluoromethyl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 158482410 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-(6-methoxy-2-piperidin-4-ylindazol-5-yl)-1-[6-(trifluoromethyl)-2-pyridinyl]ethanone |
| SMILES | COc1cc2nn(C3CCNCC3)cc2cc1CC(=O)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C21H21F3N4O2/c1-30-19-11-17-14(12-28(27-17)15-5-7-25-8-6-15)9-13(19)10-18(29)16-3-2-4-20(26-16)21(22,23)24/h2-4,9,11-12,15,25H,5-8,10H2,1H3 |
| InChIKey | HHRGFDWTGKQYQK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |