C22H24F3N5O3 — CID 163769872
N-[6-(2-methoxyethoxy)-2-piperidin-4-ylindazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 163769872) has the molecular formula C22H24F3N5O3 and a molecular weight of 463.46 g/mol. Its IUPAC name is N-[6-(2-methoxyethoxy)-2-piperidin-4-ylindazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[6-(2-methoxyethoxy)-2-piperidin-4-ylindazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 163769872 |
| Molecular Formula | C22H24F3N5O3 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[6-(2-methoxyethoxy)-2-piperidin-4-ylindazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | COCCOc1cc2nn(C3CCNCC3)cc2cc1NC(=O)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C22H24F3N5O3/c1-32-9-10-33-19-12-17-14(13-30(29-17)15-5-7-26-8-6-15)11-18(19)28-21(31)16-3-2-4-20(27-16)22(23,24)25/h2-4,11-13,15,26H,5-10H2,1H3,(H,28,31) |
| InChIKey | MFMNNWYDFLVAHX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|