C22H23F3N4O2 — CID 155752149
N-(2-cyclohexyl-6-ethoxyindazol-5-yl)-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 155752149) has the molecular formula C22H23F3N4O2 and a molecular weight of 432.45 g/mol. Its IUPAC name is N-(2-cyclohexyl-6-ethoxyindazol-5-yl)-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(2-cyclohexyl-6-ethoxyindazol-5-yl)-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155752149 |
| Molecular Formula | C22H23F3N4O2 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-(2-cyclohexyl-6-ethoxyindazol-5-yl)-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CCOc1cc2nn(C3CCCCC3)cc2cc1NC(=O)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C22H23F3N4O2/c1-2-31-19-12-17-14(13-29(28-17)15-7-4-3-5-8-15)11-18(19)27-21(30)16-9-6-10-20(26-16)22(23,24)25/h6,9-13,15H,2-5,7-8H2,1H3,(H,27,30) |
| InChIKey | YMMUJVZGYZFOCE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |