C23H23F3N4O3 — CID 155437685
N-[6-ethoxy-2-(4-formylcyclohexyl)indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 155437685) has the molecular formula C23H23F3N4O3 and a molecular weight of 460.46 g/mol. Its IUPAC name is N-[6-ethoxy-2-(4-formylcyclohexyl)indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[6-ethoxy-2-(4-formylcyclohexyl)indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155437685 |
| Molecular Formula | C23H23F3N4O3 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[6-ethoxy-2-(4-formylcyclohexyl)indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CCOc1cc2nn(C3CCC(C=O)CC3)cc2cc1NC(=O)c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C23H23F3N4O3/c1-2-33-20-11-18-15(12-30(29-18)16-8-6-14(13-31)7-9-16)10-19(20)28-22(32)17-4-3-5-21(27-17)23(24,25)26/h3-5,10-14,16H,2,6-9H2,1H3,(H,28,32) |
| InChIKey | WKGWDUREZPUNDS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|