C31H26F7NO5 — CID 171767818
(2,3,4,5-tetrafluorophenyl) 4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 171767818) has the molecular formula C31H26F7NO5 and a molecular weight of 625.54 g/mol. Its IUPAC name is (2,3,4,5-tetrafluorophenyl) 4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]bicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | (2,3,4,5-tetrafluorophenyl) 4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]bicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 171767818 |
| Molecular Formula | C31H26F7NO5 |
| Molecular Weight | 625.54 g/mol |
| Exact Mass | 625.17 |
| IUPAC Name | (2,3,4,5-tetrafluorophenyl) 4-[[[2,3,5-trifluoro-4-[(4-methoxyphenyl)methoxy]benzoyl]amino]methyl]bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | COc1ccc(COc2c(F)cc(C(=O)NCC34CCC(C(=O)Oc5cc(F)c(F)c(F)c5F)(CC3)CC4)c(F)c2F)cc1 |
| InChI | InChI=1S/C31H26F7NO5/c1-42-17-4-2-16(3-5-17)14-43-27-20(33)12-18(22(34)26(27)38)28(40)39-15-30-6-9-31(10-7-30,11-8-30)29(41)44-21-13-19(32)23(35)25(37)24(21)36/h2-5,12-13H,6-11,14-15H2,1H3,(H,39,40) |
| InChIKey | IHQBBUSOZDSSAD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.54 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|