C13H12ClF4NO — CID 166315439
N-[(1-chlorocyclopentyl)methyl]-2,3,4,5-tetrafluorobenzamide (PubChem CID 166315439) has the molecular formula C13H12ClF4NO and a molecular weight of 309.69 g/mol. Its IUPAC name is N-[(1-chlorocyclopentyl)methyl]-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-[(1-chlorocyclopentyl)methyl]-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 166315439 |
| Molecular Formula | C13H12ClF4NO |
| Molecular Weight | 309.69 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-[(1-chlorocyclopentyl)methyl]-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(NCC1(Cl)CCCC1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H12ClF4NO/c14-13(3-1-2-4-13)6-19-12(20)7-5-8(15)10(17)11(18)9(7)16/h5H,1-4,6H2,(H,19,20) |
| InChIKey | ZAEQSBJUWZPULW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.69 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|