C14H18ClF3N2O — CID 119404346
N-[(1-aminocyclohexyl)methyl]-2,3,4-trifluorobenzamide;hydrochloride (PubChem CID 119404346) has the molecular formula C14H18ClF3N2O and a molecular weight of 322.76 g/mol. Its IUPAC name is N-[(1-aminocyclohexyl)methyl]-2,3,4-trifluorobenzamide;hydrochloride.
| Compound Name | N-[(1-aminocyclohexyl)methyl]-2,3,4-trifluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119404346 |
| Molecular Formula | C14H18ClF3N2O |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[(1-aminocyclohexyl)methyl]-2,3,4-trifluorobenzamide;hydrochloride |
| SMILES | Cl.NC1(CNC(=O)c2ccc(F)c(F)c2F)CCCCC1 |
| InChI | InChI=1S/C14H17F3N2O.ClH/c15-10-5-4-9(11(16)12(10)17)13(20)19-8-14(18)6-2-1-3-7-14;/h4-5H,1-3,6-8,18H2,(H,19,20);1H |
| InChIKey | QSAOXZNVRLMSSD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|