C14H17F2NO2 — CID 113293749
2,3-difluoro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzamide (PubChem CID 113293749) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is 2,3-difluoro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzamide.
| Compound Name | 2,3-difluoro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzamide |
|---|---|
| PubChem CID | 113293749 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2,3-difluoro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzamide |
| SMILES | O=C(NCC1(CO)CCCC1)c1cccc(F)c1F |
| InChI | InChI=1S/C14H17F2NO2/c15-11-5-3-4-10(12(11)16)13(19)17-8-14(9-18)6-1-2-7-14/h3-5,18H,1-2,6-9H2,(H,17,19) |
| InChIKey | KOYNRYXSKAYLFT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |