C16H23NO4 — CID 115362436
N-[[1-(hydroxymethyl)cyclopentyl]methyl]-2,3-dimethoxybenzamide (PubChem CID 115362436) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclopentyl]methyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 115362436 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCC2(CO)CCCC2)c1OC |
| InChI | InChI=1S/C16H23NO4/c1-20-13-7-5-6-12(14(13)21-2)15(19)17-10-16(11-18)8-3-4-9-16/h5-7,18H,3-4,8-11H2,1-2H3,(H,17,19) |
| InChIKey | WMLQCAGTCXKBAF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |