C21H24ClNO4 — CID 27449051
N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2,3-dimethoxybenzamide (PubChem CID 27449051) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 27449051 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCC2(c3ccc(Cl)cc3)CCOCC2)c1OC |
| InChI | InChI=1S/C21H24ClNO4/c1-25-18-5-3-4-17(19(18)26-2)20(24)23-14-21(10-12-27-13-11-21)15-6-8-16(22)9-7-15/h3-9H,10-14H2,1-2H3,(H,23,24) |
| InChIKey | JSGLUWRKUAGKKE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |