C19H18BrCl2NO2 — CID 27449067
5-bromo-2-chloro-N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]benzamide (PubChem CID 27449067) has the molecular formula C19H18BrCl2NO2 and a molecular weight of 443.17 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 27449067 |
| Molecular Formula | C19H18BrCl2NO2 |
| Molecular Weight | 443.17 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | 5-bromo-2-chloro-N-[[4-(4-chlorophenyl)oxan-4-yl]methyl]benzamide |
| SMILES | O=C(NCC1(c2ccc(Cl)cc2)CCOCC1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C19H18BrCl2NO2/c20-14-3-6-17(22)16(11-14)18(24)23-12-19(7-9-25-10-8-19)13-1-4-15(21)5-2-13/h1-6,11H,7-10,12H2,(H,23,24) |
| InChIKey | LQXYRJKXWVWPRP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.17 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |