C20H18BrF4NO2 — CID 60620970
N-[[4-(4-bromophenyl)oxan-4-yl]methyl]-4-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 60620970) has the molecular formula C20H18BrF4NO2 and a molecular weight of 460.27 g/mol. Its IUPAC name is N-[[4-(4-bromophenyl)oxan-4-yl]methyl]-4-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-[[4-(4-bromophenyl)oxan-4-yl]methyl]-4-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 60620970 |
| Molecular Formula | C20H18BrF4NO2 |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | N-[[4-(4-bromophenyl)oxan-4-yl]methyl]-4-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1(c2ccc(Br)cc2)CCOCC1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18BrF4NO2/c21-15-4-2-14(3-5-15)19(7-9-28-10-8-19)12-26-18(27)13-1-6-17(22)16(11-13)20(23,24)25/h1-6,11H,7-10,12H2,(H,26,27) |
| InChIKey | OXGDMVOMIDNZPK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |