C14H18BrFN2O — CID 119404297
N-[(1-aminocyclohexyl)methyl]-5-bromo-2-fluorobenzamide (PubChem CID 119404297) has the molecular formula C14H18BrFN2O and a molecular weight of 329.21 g/mol. Its IUPAC name is N-[(1-aminocyclohexyl)methyl]-5-bromo-2-fluorobenzamide.
| Compound Name | N-[(1-aminocyclohexyl)methyl]-5-bromo-2-fluorobenzamide |
|---|---|
| PubChem CID | 119404297 |
| Molecular Formula | C14H18BrFN2O |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-[(1-aminocyclohexyl)methyl]-5-bromo-2-fluorobenzamide |
| SMILES | NC1(CNC(=O)c2cc(Br)ccc2F)CCCCC1 |
| InChI | InChI=1S/C14H18BrFN2O/c15-10-4-5-12(16)11(8-10)13(19)18-9-14(17)6-2-1-3-7-14/h4-5,8H,1-3,6-7,9,17H2,(H,18,19) |
| InChIKey | GGFHWOANWKLUIN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |