C29H33NO4 — CID 58923644
N-[[4-[(4-methoxyphenoxy)methyl]cyclohexyl]methyl]-4-phenylmethoxybenzamide (PubChem CID 58923644) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[[4-[(4-methoxyphenoxy)methyl]cyclohexyl]methyl]-4-phenylmethoxybenzamide.
| Compound Name | N-[[4-[(4-methoxyphenoxy)methyl]cyclohexyl]methyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 58923644 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | N-[[4-[(4-methoxyphenoxy)methyl]cyclohexyl]methyl]-4-phenylmethoxybenzamide |
| SMILES | COc1ccc(OCC2CCC(CNC(=O)c3ccc(OCc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H33NO4/c1-32-26-15-17-28(18-16-26)34-21-24-9-7-22(8-10-24)19-30-29(31)25-11-13-27(14-12-25)33-20-23-5-3-2-4-6-23/h2-6,11-18,22,24H,7-10,19-21H2,1H3,(H,30,31) |
| InChIKey | CHZDCVBYGBZROK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |