C22H27NO5 — CID 58923734
4-(methoxymethoxy)-N-[[5-(phenoxymethyl)oxan-2-yl]methyl]benzamide (PubChem CID 58923734) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-(methoxymethoxy)-N-[[5-(phenoxymethyl)oxan-2-yl]methyl]benzamide.
| Compound Name | 4-(methoxymethoxy)-N-[[5-(phenoxymethyl)oxan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 58923734 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-(methoxymethoxy)-N-[[5-(phenoxymethyl)oxan-2-yl]methyl]benzamide |
| SMILES | COCOc1ccc(C(=O)NCC2CCC(COc3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C22H27NO5/c1-25-16-28-20-11-8-18(9-12-20)22(24)23-13-21-10-7-17(15-27-21)14-26-19-5-3-2-4-6-19/h2-6,8-9,11-12,17,21H,7,10,13-16H2,1H3,(H,23,24) |
| InChIKey | ZCFKBLBTISBPIM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|