C13H19NO2 — CID 129389570
[(2S,5S)-5-(phenoxymethyl)oxan-2-yl]methanamine (PubChem CID 129389570) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is [(2S,5S)-5-(phenoxymethyl)oxan-2-yl]methanamine.
| Compound Name | [(2S,5S)-5-(phenoxymethyl)oxan-2-yl]methanamine |
|---|---|
| PubChem CID | 129389570 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | [(2S,5S)-5-(phenoxymethyl)oxan-2-yl]methanamine |
| SMILES | NC[C@@H]1CC[C@H](COc2ccccc2)CO1 |
| InChI | InChI=1S/C13H19NO2/c14-8-13-7-6-11(10-16-13)9-15-12-4-2-1-3-5-12/h1-5,11,13H,6-10,14H2/t11-,13+/m1/s1 |
| InChIKey | UQAXLWWYSGHXCB-YPMHNXCESA-N |
| XLogP | 1.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |