C19H21NO3 — CID 24684666
N-(oxolan-2-ylmethyl)-4-(phenoxymethyl)benzamide (PubChem CID 24684666) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-4-(phenoxymethyl)benzamide.
| Compound Name | N-(oxolan-2-ylmethyl)-4-(phenoxymethyl)benzamide |
|---|---|
| PubChem CID | 24684666 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-4-(phenoxymethyl)benzamide |
| SMILES | O=C(NCC1CCCO1)c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C19H21NO3/c21-19(20-13-18-7-4-12-22-18)16-10-8-15(9-11-16)14-23-17-5-2-1-3-6-17/h1-3,5-6,8-11,18H,4,7,12-14H2,(H,20,21) |
| InChIKey | VQFJTXQLYBFMLA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |