C19H25NO4 — CID 57445670
N-(cyclohexylmethyl)-3,5-dimethoxy-4-prop-2-ynoxybenzamide (PubChem CID 57445670) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3,5-dimethoxy-4-prop-2-ynoxybenzamide.
| Compound Name | N-(cyclohexylmethyl)-3,5-dimethoxy-4-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 57445670 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-(cyclohexylmethyl)-3,5-dimethoxy-4-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1c(OC)cc(C(=O)NCC2CCCCC2)cc1OC |
| InChI | InChI=1S/C19H25NO4/c1-4-10-24-18-16(22-2)11-15(12-17(18)23-3)19(21)20-13-14-8-6-5-7-9-14/h1,11-12,14H,5-10,13H2,2-3H3,(H,20,21) |
| InChIKey | NXTBCXZPJUMRBG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|