C14H15ClF3NO2 — CID 106134004
N-[(4-chlorocyclohexyl)methyl]-2,4,5-trifluoro-3-hydroxybenzamide (PubChem CID 106134004) has the molecular formula C14H15ClF3NO2 and a molecular weight of 321.73 g/mol. Its IUPAC name is N-[(4-chlorocyclohexyl)methyl]-2,4,5-trifluoro-3-hydroxybenzamide.
| Compound Name | N-[(4-chlorocyclohexyl)methyl]-2,4,5-trifluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 106134004 |
| Molecular Formula | C14H15ClF3NO2 |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[(4-chlorocyclohexyl)methyl]-2,4,5-trifluoro-3-hydroxybenzamide |
| SMILES | O=C(NCC1CCC(Cl)CC1)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C14H15ClF3NO2/c15-8-3-1-7(2-4-8)6-19-14(21)9-5-10(16)12(18)13(20)11(9)17/h5,7-8,20H,1-4,6H2,(H,19,21) |
| InChIKey | QXYFEFOVCFWKIH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|