C13H13Cl2F2NO — CID 114146975
4-chloro-N-[(3-chlorocyclopentyl)methyl]-2,5-difluorobenzamide (PubChem CID 114146975) has the molecular formula C13H13Cl2F2NO and a molecular weight of 308.16 g/mol. Its IUPAC name is 4-chloro-N-[(3-chlorocyclopentyl)methyl]-2,5-difluorobenzamide.
| Compound Name | 4-chloro-N-[(3-chlorocyclopentyl)methyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 114146975 |
| Molecular Formula | C13H13Cl2F2NO |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 4-chloro-N-[(3-chlorocyclopentyl)methyl]-2,5-difluorobenzamide |
| SMILES | O=C(NCC1CCC(Cl)C1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H13Cl2F2NO/c14-8-2-1-7(3-8)6-18-13(19)9-4-12(17)10(15)5-11(9)16/h4-5,7-8H,1-3,6H2,(H,18,19) |
| InChIKey | UKYJPAQOMWZHJB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|