C13H15ClFNO — CID 106127378
N-[(3-chlorocyclopentyl)methyl]-4-fluorobenzamide (PubChem CID 106127378) has the molecular formula C13H15ClFNO and a molecular weight of 255.72 g/mol. Its IUPAC name is N-[(3-chlorocyclopentyl)methyl]-4-fluorobenzamide.
| Compound Name | N-[(3-chlorocyclopentyl)methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 106127378 |
| Molecular Formula | C13H15ClFNO |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-[(3-chlorocyclopentyl)methyl]-4-fluorobenzamide |
| SMILES | O=C(NCC1CCC(Cl)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15ClFNO/c14-11-4-1-9(7-11)8-16-13(17)10-2-5-12(15)6-3-10/h2-3,5-6,9,11H,1,4,7-8H2,(H,16,17) |
| InChIKey | LRRVQQSZPMIMOS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|