C18H24FNO — CID 71090797
N-(3-bicyclo[5.2.1]decanylmethyl)-4-fluorobenzamide (PubChem CID 71090797) has the molecular formula C18H24FNO and a molecular weight of 289.39 g/mol. Its IUPAC name is N-(3-bicyclo[5.2.1]decanylmethyl)-4-fluorobenzamide.
| Compound Name | N-(3-bicyclo[5.2.1]decanylmethyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 71090797 |
| Molecular Formula | C18H24FNO |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-(3-bicyclo[5.2.1]decanylmethyl)-4-fluorobenzamide |
| SMILES | O=C(NCC1CCCC2CCC(C2)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FNO/c19-17-8-6-16(7-9-17)18(21)20-12-15-3-1-2-13-4-5-14(10-13)11-15/h6-9,13-15H,1-5,10-12H2,(H,20,21) |
| InChIKey | QYNDBSITTQLYBD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |