C14H16BrClFNO — CID 106133673
3-bromo-N-[(4-chlorocyclohexyl)methyl]-5-fluorobenzamide (PubChem CID 106133673) has the molecular formula C14H16BrClFNO and a molecular weight of 348.64 g/mol. Its IUPAC name is 3-bromo-N-[(4-chlorocyclohexyl)methyl]-5-fluorobenzamide.
| Compound Name | 3-bromo-N-[(4-chlorocyclohexyl)methyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 106133673 |
| Molecular Formula | C14H16BrClFNO |
| Molecular Weight | 348.64 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 3-bromo-N-[(4-chlorocyclohexyl)methyl]-5-fluorobenzamide |
| SMILES | O=C(NCC1CCC(Cl)CC1)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C14H16BrClFNO/c15-11-5-10(6-13(17)7-11)14(19)18-8-9-1-3-12(16)4-2-9/h5-7,9,12H,1-4,8H2,(H,18,19) |
| InChIKey | NSKFXLJPZSBMDB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|